Products 1346598-46-6
CAS 1346598-46-6 appears in our catalog under these names: 2-(2-(2-Butoxyethoxy)ethoxy)tetrahydropyran-d9, 2-[2-(2-Butoxyethoxy)ethoxy]tetrahydropyran-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
2-[2-[2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)ethoxy]ethoxy]oxane (CAS 1346598-46-6) is a chemical compound with the molecular formula C13H26O4 and a molecular weight of 255.40 g/mol. IUPAC name: 2-[2-[2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)ethoxy]ethoxy]oxane. InChIKey: IQQBHEHGOZAWPW-AZOWHCDPSA-N.
| Molecular formula | C13H26O4 |
|---|---|
| Molecular weight | 255.40 g/mol |
| IUPAC name | 2-[2-[2-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)ethoxy]ethoxy]oxane |
| InChIKey | IQQBHEHGOZAWPW-AZOWHCDPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OCCOCCOC1CCCCO1 |
Computed by PubChem (NCBI)