Products 34443-12-4

CAS 34443-12-4 is the registry number for LUPEROX(R) TBEC, TERT-BUTYLPEROXY 2-ETH&. Offered by: Sigma-Aldrich. Available pack sizes: 100ML, 500ML.

Structural formula: {0} (CAS {1})

2-ethylhexyl (2-methylpropan-2-yl)oxy carbonate (CAS 34443-12-4) is a chemical compound with the molecular formula C13H26O4 and a molecular weight of 246.34 g/mol. IUPAC name: 2-ethylhexyl (2-methylpropan-2-yl)oxy carbonate. InChIKey: BRQMAAFGEXNUOL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H26O4
Molecular weight246.34 g/mol
IUPAC name2-ethylhexyl (2-methylpropan-2-yl)oxy carbonate
InChIKeyBRQMAAFGEXNUOL-UHFFFAOYSA-N
SMILESCCCCC(CC)COC(=O)OOC(C)(C)C

Computed by PubChem (NCBI)