Products 1346598-59-1
CAS 1346598-59-1 is the registry number for Depropylamino Hydroxy Propafenone-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
1-[2-(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropoxy)phenyl]-3-phenylpropan-1-one (CAS 1346598-59-1) is a chemical compound with the molecular formula C18H20O4 and a molecular weight of 305.4 g/mol. IUPAC name: 1-[2-(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropoxy)phenyl]-3-phenylpropan-1-one. InChIKey: KRSTZDUMPGTWJG-YZYYPZMPSA-N.
| Molecular formula | C18H20O4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-[2-(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropoxy)phenyl]-3-phenylpropan-1-one |
| InChIKey | KRSTZDUMPGTWJG-YZYYPZMPSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)