Products 1346600-02-9
CAS 1346600-02-9 appears in our catalog under these names: rac Matairesinol-d6, >95% (HPLC), Matairesinol-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(3S,4S)-3,4-bis[(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)methyl]oxolan-2-one (CAS 1346600-02-9) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 364.4 g/mol. IUPAC name: (3S,4S)-3,4-bis[(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)methyl]oxolan-2-one. InChIKey: MATGKVZWFZHCLI-NIQITUMISA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | (3S,4S)-3,4-bis[(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)methyl]oxolan-2-one |
| InChIKey | MATGKVZWFZHCLI-NIQITUMISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C[C@@H]2COC(=O)[C@H]2CC3=C(C(=C(C(=C3[2H])[2H])O)OC)[2H])[2H])OC)O)[2H] |
Computed by PubChem (NCBI)