CAS 1346600-06-3 is the registry number for rac Deoxy-O-desmethyl venlafaxine-d6. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-[bis(trideuteriomethyl)amino]-1-cyclohexylethyl]phenol (CAS 1346600-06-3) is a chemical compound with the molecular formula C16H25NO and a molecular weight of 253.41 g/mol. IUPAC name: 4-[2-[bis(trideuteriomethyl)amino]-1-cyclohexylethyl]phenol. InChIKey: BKCFZQQZVCEESN-WFGJKAKNSA-N.
| Molecular formula | C16H25NO |
|---|---|
| Molecular weight | 253.41 g/mol |
| IUPAC name | 4-[2-[bis(trideuteriomethyl)amino]-1-cyclohexylethyl]phenol |
| InChIKey | BKCFZQQZVCEESN-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C1CCCCC1)C2=CC=C(C=C2)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)