Products 1346600-35-8
CAS 1346600-35-8 appears in our catalog under these names: Alpha-Muethyl-6-benzofuran Ethanamine-d6 Hydrochloride (6-APB-d6 Hydrochloride), >95% (HPLC), alpha-Methyl-6-benzofuran Ethanamine-d6 Hydrochloride (6-APB-d6 Hydrochloride), >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
1-(1-benzofuran-6-yl)-1,1,2,3,3,3-hexadeuteriopropan-2-amine;hydrochloride (CAS 1346600-35-8) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 217.72 g/mol. IUPAC name: 1-(1-benzofuran-6-yl)-1,1,2,3,3,3-hexadeuteriopropan-2-amine;hydrochloride. InChIKey: APEWOTOLPKNSPE-WHYQSJAVSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 217.72 g/mol |
| IUPAC name | 1-(1-benzofuran-6-yl)-1,1,2,3,3,3-hexadeuteriopropan-2-amine;hydrochloride |
| InChIKey | APEWOTOLPKNSPE-WHYQSJAVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])C1=CC2=C(C=C1)C=CO2)N.Cl |
Computed by PubChem (NCBI)