CAS 1346600-46-1 is the registry number for rac Benzphetamine-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg.
N-benzyl-1-phenyl-N-(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 1346600-46-1) is a chemical compound with the molecular formula C17H22ClN and a molecular weight of 278.8 g/mol. IUPAC name: N-benzyl-1-phenyl-N-(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: ANFSNXAXVLRZCG-MUTAZJQDSA-N.
| Molecular formula | C17H22ClN |
|---|---|
| Molecular weight | 278.8 g/mol |
| IUPAC name | N-benzyl-1-phenyl-N-(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | ANFSNXAXVLRZCG-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])N(CC1=CC=CC=C1)C(C)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)