CAS 28646-36-8 appears in our catalog under these names: (R)-Benzphetamine Hydrochloride, >95% (HPLC), (R)-Benzphetamine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 250mg, 50mg, 2mg, 5mg, 25mg.
(2R)-N-benzyl-N-methyl-1-phenylpropan-2-amine;hydrochloride (CAS 28646-36-8) is a chemical compound with the molecular formula C17H22ClN and a molecular weight of 275.8 g/mol. IUPAC name: (2R)-N-benzyl-N-methyl-1-phenylpropan-2-amine;hydrochloride. InChIKey: ANFSNXAXVLRZCG-XFULWGLBSA-N.
| Molecular formula | C17H22ClN |
|---|---|
| Molecular weight | 275.8 g/mol |
| IUPAC name | (2R)-N-benzyl-N-methyl-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | ANFSNXAXVLRZCG-XFULWGLBSA-N |
| SMILES | C[C@H](CC1=CC=CC=C1)N(C)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)