Products 1346600-88-1
CAS 1346600-88-1 is the registry number for cis,trans-(1,1-Dimethylethoxy)carbonyl Tranexamic Acid Methyl Ester-13C2,15N. Offered by: TRC. Available pack sizes: 10mg, 1mg.
Methyl 4-[[(2-methylpropan-2-yl)oxycarbonyl(15N)amino](113C)methyl]cyclohexane-1-carboxylate (CAS 1346600-88-1) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 274.33 g/mol. IUPAC name: methyl 4-[[(2-methylpropan-2-yl)oxycarbonyl(15N)amino](113C)methyl]cyclohexane-1-carboxylate. InChIKey: JRJOPLNDRJAOCP-MBKNFTEHSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 274.33 g/mol |
| IUPAC name | methyl 4-[[(2-methylpropan-2-yl)oxycarbonyl(15N)amino](113C)methyl]cyclohexane-1-carboxylate |
| InChIKey | JRJOPLNDRJAOCP-MBKNFTEHSA-N |
| SMILES | CC(C)(C)OC(=O)[15NH][13CH2]C1CCC(CC1)[13C](=O)OC |
Computed by PubChem (NCBI)