CAS 1346600-97-2 appears in our catalog under these names: 1-(Pentyl-d11)-3-(1-naphthoyl)indoleJWH 018-d11, >95% (HPLC), JWH-018-D11, JWH-018-D11, 0.1mg/ml in Methanol, JWH-018-D11, 1mg/ml in Methanol. Offered by: TRC, Lipomed. Available pack sizes: 10mg, 1mg, 50mg, 100mg, 1ml.
Naphthalen-1-yl-[1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indol-3-yl]methanone (CAS 1346600-97-2) is a chemical compound with the molecular formula C24H23NO and a molecular weight of 352.5 g/mol. IUPAC name: naphthalen-1-yl-[1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indol-3-yl]methanone. InChIKey: JDNLPKCAXICMBW-IHULVLPZSA-N.
| Molecular formula | C24H23NO |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | naphthalen-1-yl-[1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indol-3-yl]methanone |
| InChIKey | JDNLPKCAXICMBW-IHULVLPZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)