Products 1415744-44-3

CAS 1415744-44-3 is the registry number for JWH 018-d9. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Naphthalen-1-yl-[1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indol-3-yl]methanone (CAS 1415744-44-3) is a chemical compound with the molecular formula C24H23NO and a molecular weight of 350.5 g/mol. IUPAC name: naphthalen-1-yl-[1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indol-3-yl]methanone. InChIKey: JDNLPKCAXICMBW-WRMMWXQOSA-N.

Identity
Molecular formulaC24H23NO
Molecular weight350.5 g/mol
IUPAC namenaphthalen-1-yl-[1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indol-3-yl]methanone
InChIKeyJDNLPKCAXICMBW-WRMMWXQOSA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43

Computed by PubChem (NCBI)