Products 1346601-42-0
CAS 1346601-42-0 appears in our catalog under these names: Ketobemidone-d3, Ketobemidone-d3 (1mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 2,5mg, 25mg, 1x1ml.
3,3,3-trideuterio-1-[4-(3-hydroxyphenyl)-1-methylpiperidin-4-yl]propan-1-one (CAS 1346601-42-0) is a chemical compound with the molecular formula C15H21NO2 and a molecular weight of 250.35 g/mol. IUPAC name: 3,3,3-trideuterio-1-[4-(3-hydroxyphenyl)-1-methylpiperidin-4-yl]propan-1-one. InChIKey: ALFGKMXHOUSVAD-FIBGUPNXSA-N.
| Molecular formula | C15H21NO2 |
|---|---|
| Molecular weight | 250.35 g/mol |
| IUPAC name | 3,3,3-trideuterio-1-[4-(3-hydroxyphenyl)-1-methylpiperidin-4-yl]propan-1-one |
| InChIKey | ALFGKMXHOUSVAD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)C1(CCN(CC1)C)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)