Products 1346601-45-3
CAS 1346601-45-3 is the registry number for Dimethocaine-d4 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg.
[3-(diethylamino)-2,2-dimethylpropyl] 4-amino-2,3,5,6-tetradeuteriobenzoate;hydrochloride (CAS 1346601-45-3) is a chemical compound with the molecular formula C16H27ClN2O2 and a molecular weight of 318.87 g/mol. IUPAC name: [3-(diethylamino)-2,2-dimethylpropyl] 4-amino-2,3,5,6-tetradeuteriobenzoate;hydrochloride. InChIKey: WWTWKTDXBNHESE-KQWCWKDASA-N.
| Molecular formula | C16H27ClN2O2 |
|---|---|
| Molecular weight | 318.87 g/mol |
| IUPAC name | [3-(diethylamino)-2,2-dimethylpropyl] 4-amino-2,3,5,6-tetradeuteriobenzoate;hydrochloride |
| InChIKey | WWTWKTDXBNHESE-KQWCWKDASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OCC(C)(C)CN(CC)CC)[2H])[2H])N)[2H].Cl |
Computed by PubChem (NCBI)
Synonyms:
Dimethocaine-d4 Hydrochloride