CAS 553-63-9 appears in our catalog under these names: 3-(Diethylamino)-2,2-dimethylpropyl 4-aminobenzoate hydrochloride, 98%, Dimethocaine Hydrochloride, >95% (HPLC), Dimethocaine Hydrochloride, Dimethocaine Hydrochloride 1.0 mg/ml in Methanol (as free base), Dimethocaine (hydrochloride). Offered by: Combi-blocks, TRC, LoGiCal, GLPBio, Biosynth. Available pack sizes: 1g, 10mg, 5mg, 1ml, 1mg, 10g, 5g, 25g.
[3-(diethylamino)-2,2-dimethylpropyl] 4-aminobenzoate;hydrochloride (CAS 553-63-9) is a chemical compound with the molecular formula C16H27ClN2O2 and a molecular weight of 314.8 g/mol. IUPAC name: [3-(diethylamino)-2,2-dimethylpropyl] 4-aminobenzoate;hydrochloride. InChIKey: WWTWKTDXBNHESE-UHFFFAOYSA-N.
| Molecular formula | C16H27ClN2O2 |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | [3-(diethylamino)-2,2-dimethylpropyl] 4-aminobenzoate;hydrochloride |
| InChIKey | WWTWKTDXBNHESE-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(C)(C)COC(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)