Products 1346601-47-5
CAS 1346601-47-5 is the registry number for 2-(((4-Cyanophenyl)amino)methyl)-1-methyl-1H-benzimidazole-5-carboxylic-d3 Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 0,5mg, 5mg.
Ethyl 2-[(4-cyanoanilino)methyl]-1-(trideuteriomethyl)benzimidazole-5-carboxylate (CAS 1346601-47-5) is a chemical compound with the molecular formula C19H18N4O2 and a molecular weight of 337.4 g/mol. IUPAC name: ethyl 2-[(4-cyanoanilino)methyl]-1-(trideuteriomethyl)benzimidazole-5-carboxylate. InChIKey: XTZBKPCEGBUIMM-BMSJAHLVSA-N.
| Molecular formula | C19H18N4O2 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | ethyl 2-[(4-cyanoanilino)methyl]-1-(trideuteriomethyl)benzimidazole-5-carboxylate |
| InChIKey | XTZBKPCEGBUIMM-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C=C(C=C2)C(=O)OCC)N=C1CNC3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)