Products 1117893-66-9
CAS 1117893-66-9 is the registry number for Dabigatran Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carboxylate (CAS 1117893-66-9) is a chemical compound with the molecular formula C19H18N4O2 and a molecular weight of 334.4 g/mol. IUPAC name: ethyl 2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carboxylate. InChIKey: XTZBKPCEGBUIMM-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | ethyl 2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carboxylate |
| InChIKey | XTZBKPCEGBUIMM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(C(=N2)CNC3=CC=C(C=C3)C#N)C |
Computed by PubChem (NCBI)