Products 866051-63-0

CAS 866051-63-0 is the registry number for Ethyl 5-(benzylamino)-3-phenyl-1,2,4-triazine-6-carboxylate, 90%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl 5-(benzylamino)-3-phenyl-1,2,4-triazine-6-carboxylate (CAS 866051-63-0) is a chemical compound with the molecular formula C19H18N4O2 and a molecular weight of 334.4 g/mol. IUPAC name: ethyl 5-(benzylamino)-3-phenyl-1,2,4-triazine-6-carboxylate. InChIKey: ALNHTMIMVNUJFH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N4O2
Molecular weight334.4 g/mol
IUPAC nameethyl 5-(benzylamino)-3-phenyl-1,2,4-triazine-6-carboxylate
InChIKeyALNHTMIMVNUJFH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=C(N=N1)C2=CC=CC=C2)NCC3=CC=CC=C3

Computed by PubChem (NCBI)