Products 1346601-49-7
CAS 1346601-49-7 is the registry number for Metaproterenol-d7 Hemisulfate Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
5-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]benzene-1,3-diol;sulfuric acid (CAS 1346601-49-7) is a chemical compound with the molecular formula C11H19NO7S and a molecular weight of 316.38 g/mol. IUPAC name: 5-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]benzene-1,3-diol;sulfuric acid. InChIKey: KSADBGVWHQJPAL-AUYCXRIESA-N.
| Molecular formula | C11H19NO7S |
|---|---|
| Molecular weight | 316.38 g/mol |
| IUPAC name | 5-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-hydroxyethyl]benzene-1,3-diol;sulfuric acid |
| InChIKey | KSADBGVWHQJPAL-AUYCXRIESA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(C1=CC(=CC(=C1)O)O)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)