CAS 202477-59-6 is the registry number for (2S,4R)-1-(tert-Butoxycarbonyl)-4-((methylsulfonyl)oxy)pyrrolidine-2-carboxylic acid, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 100mg, 25g, 250mg, 1g, 5g, 10g.
(2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonyloxypyrrolidine-2-carboxylic acid (CAS 202477-59-6) is a chemical compound with the molecular formula C11H19NO7S and a molecular weight of 309.34 g/mol. IUPAC name: (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonyloxypyrrolidine-2-carboxylic acid. InChIKey: OGGZSVXCHFNXKA-SFYZADRCSA-N.
| Molecular formula | C11H19NO7S |
|---|---|
| Molecular weight | 309.34 g/mol |
| IUPAC name | (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-methylsulfonyloxypyrrolidine-2-carboxylic acid |
| InChIKey | OGGZSVXCHFNXKA-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)OS(=O)(=O)C |
Computed by PubChem (NCBI)