CAS 1346601-79-3 is the registry number for 2-Methyl-1-tetralone-13C6. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2-methyl-3,4-dihydro-2H-naphthalen-1-one (CAS 1346601-79-3) is a chemical compound with the molecular formula C11H12O and a molecular weight of 166.17 g/mol. IUPAC name: 2-methyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: GANIBVZSZGNMNB-MEHVTQSOSA-N.
| Molecular formula | C11H12O |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | 2-methyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | GANIBVZSZGNMNB-MEHVTQSOSA-N |
| SMILES | C[13CH]1[13CH2][13CH2][13C]2=[13CH]C=CC=C2[13C]1=O |
Computed by PubChem (NCBI)