CAS 1346601-80-6 is the registry number for Buphedrone-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1-phenyl-2-(trideuteriomethylamino)butan-1-one;hydrochloride (CAS 1346601-80-6) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 216.72 g/mol. IUPAC name: 1-phenyl-2-(trideuteriomethylamino)butan-1-one;hydrochloride. InChIKey: WJQBARDMJLAIJX-MUTAZJQDSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 216.72 g/mol |
| IUPAC name | 1-phenyl-2-(trideuteriomethylamino)butan-1-one;hydrochloride |
| InChIKey | WJQBARDMJLAIJX-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(CC)C(=O)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)