CAS 1346602-10-5 is the registry number for 3-Methylthiofentanyl-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
3,3,3-trideuterio-N-[3-methyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide (CAS 1346602-10-5) is a chemical compound with the molecular formula C21H28N2OS and a molecular weight of 359.5 g/mol. IUPAC name: 3,3,3-trideuterio-N-[3-methyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide. InChIKey: SRARDYUHGVMEQI-FIBGUPNXSA-N.
| Molecular formula | C21H28N2OS |
|---|---|
| Molecular weight | 359.5 g/mol |
| IUPAC name | 3,3,3-trideuterio-N-[3-methyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-N-phenylpropanamide |
| InChIKey | SRARDYUHGVMEQI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)N(C1CCN(CC1C)CCC2=CC=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)