CAS 1710690-59-7 is the registry number for 14-Phenylthio Matridin-15-one. Offered by: TRC. Available pack sizes: 1g.
(1R,2R,9S,17S)-5-phenylsulfanyl-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (CAS 1710690-59-7) is a chemical compound with the molecular formula C21H28N2OS and a molecular weight of 356.5 g/mol. IUPAC name: (1R,2R,9S,17S)-5-phenylsulfanyl-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one. InChIKey: ZZJFQHHLRGFJTB-GSIQVPGLSA-N.
| Molecular formula | C21H28N2OS |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | (1R,2R,9S,17S)-5-phenylsulfanyl-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| InChIKey | ZZJFQHHLRGFJTB-GSIQVPGLSA-N |
| SMILES | C1C[C@H]2CN3[C@H](CCC(C3=O)SC4=CC=CC=C4)[C@@H]5[C@H]2N(C1)CCC5 |
Computed by PubChem (NCBI)