Products 1346602-86-5
CAS 1346602-86-5 appears in our catalog under these names: 4-Octylphenol-d4 Monoethoxylate (Major), >95% (HPLC), 4-Octylphenol monoethoxylate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2-(2,3,5,6-tetradeuterio-4-octylphenoxy)ethanol (CAS 1346602-86-5) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 254.40 g/mol. IUPAC name: 2-(2,3,5,6-tetradeuterio-4-octylphenoxy)ethanol. InChIKey: BHNQPLPANNDEGL-IRYCTXJYSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 254.40 g/mol |
| IUPAC name | 2-(2,3,5,6-tetradeuterio-4-octylphenoxy)ethanol |
| InChIKey | BHNQPLPANNDEGL-IRYCTXJYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCCCCCCC)[2H])[2H])OCCO)[2H] |
Computed by PubChem (NCBI)