CAS 1346603-10-8 is the registry number for N-Nitroso-N,N-di(3,5,5-trimethylhexyl)amine-d4, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
N,N-bis(1,1-dideuterio-3,5,5-trimethylhexyl)nitrous amide (CAS 1346603-10-8) is a chemical compound with the molecular formula C18H38N2O and a molecular weight of 302.5 g/mol. IUPAC name: N,N-bis(1,1-dideuterio-3,5,5-trimethylhexyl)nitrous amide. InChIKey: JAXCREYHJGJFGI-AREBVXNXSA-N.
| Molecular formula | C18H38N2O |
|---|---|
| Molecular weight | 302.5 g/mol |
| IUPAC name | N,N-bis(1,1-dideuterio-3,5,5-trimethylhexyl)nitrous amide |
| InChIKey | JAXCREYHJGJFGI-AREBVXNXSA-N |
| SMILES | [2H]C([2H])(CC(C)CC(C)(C)C)N(C([2H])([2H])CC(C)CC(C)(C)C)N=O |
Computed by PubChem (NCBI)