CAS 1794754-41-8 appears in our catalog under these names: N-Nitroso-N,N-di-(7-methyloctyl)amine-d4, >95% (HPLC), N-Nitroso-N,N-di-(7-methyloctyl)amine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
N,N-bis(1,1-dideuterio-7-methyloctyl)nitrous amide (CAS 1794754-41-8) is a chemical compound with the molecular formula C18H38N2O and a molecular weight of 302.5 g/mol. IUPAC name: N,N-bis(1,1-dideuterio-7-methyloctyl)nitrous amide. InChIKey: XAYFTZOFOLGWAE-ONNKGWAKSA-N.
| Molecular formula | C18H38N2O |
|---|---|
| Molecular weight | 302.5 g/mol |
| IUPAC name | N,N-bis(1,1-dideuterio-7-methyloctyl)nitrous amide |
| InChIKey | XAYFTZOFOLGWAE-ONNKGWAKSA-N |
| SMILES | [2H]C([2H])(CCCCCC(C)C)N(C([2H])([2H])CCCCCC(C)C)N=O |
Computed by PubChem (NCBI)