CAS 1346603-32-4 appears in our catalog under these names: Tapentadol-d5 N-Oxide, Tapentadol N-Oxide-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(2R,3R)-4,4,5,5,5-pentadeuterio-3-(3-hydroxyphenyl)-N,N,2-trimethylpentan-1-amine oxide (CAS 1346603-32-4) is a chemical compound with the molecular formula C14H23NO2 and a molecular weight of 242.37 g/mol. IUPAC name: (2R,3R)-4,4,5,5,5-pentadeuterio-3-(3-hydroxyphenyl)-N,N,2-trimethylpentan-1-amine oxide. InChIKey: QJMYEQICSAOVMO-ODWVCUCBSA-N.
| Molecular formula | C14H23NO2 |
|---|---|
| Molecular weight | 242.37 g/mol |
| IUPAC name | (2R,3R)-4,4,5,5,5-pentadeuterio-3-(3-hydroxyphenyl)-N,N,2-trimethylpentan-1-amine oxide |
| InChIKey | QJMYEQICSAOVMO-ODWVCUCBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@@H](C1=CC(=CC=C1)O)[C@@H](C)C[N+](C)(C)[O-] |
Computed by PubChem (NCBI)