Products 1346603-83-5

CAS 1346603-83-5 is the registry number for Butibufen-d5. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 10 mg, 100 mg.

Structural formula: {0} (CAS {1})

3,3,4,4,4-pentadeuterio-2-[4-(2-methylpropyl)phenyl]butanoic acid (CAS 1346603-83-5) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 225.34 g/mol. IUPAC name: 3,3,4,4,4-pentadeuterio-2-[4-(2-methylpropyl)phenyl]butanoic acid. InChIKey: UULSXYSSHHRCQK-SGEUAGPISA-N.

Identity
Molecular formulaC14H20O2
Molecular weight225.34 g/mol
IUPAC name3,3,4,4,4-pentadeuterio-2-[4-(2-methylpropyl)phenyl]butanoic acid
InChIKeyUULSXYSSHHRCQK-SGEUAGPISA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])C(C1=CC=C(C=C1)CC(C)C)C(=O)O

Computed by PubChem (NCBI)