CAS 1346603-83-5 is the registry number for Butibufen-d5. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 10 mg, 100 mg.
3,3,4,4,4-pentadeuterio-2-[4-(2-methylpropyl)phenyl]butanoic acid (CAS 1346603-83-5) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 225.34 g/mol. IUPAC name: 3,3,4,4,4-pentadeuterio-2-[4-(2-methylpropyl)phenyl]butanoic acid. InChIKey: UULSXYSSHHRCQK-SGEUAGPISA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 225.34 g/mol |
| IUPAC name | 3,3,4,4,4-pentadeuterio-2-[4-(2-methylpropyl)phenyl]butanoic acid |
| InChIKey | UULSXYSSHHRCQK-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(C1=CC=C(C=C1)CC(C)C)C(=O)O |
Computed by PubChem (NCBI)