CAS 1346603-90-4 appears in our catalog under these names: rac Secoisolariciresinol-d6, >95% (HPLC), (+)-Secoisolariciresinol-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
(2R,3R)-2,3-bis[(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)methyl]butane-1,4-diol (CAS 1346603-90-4) is a chemical compound with the molecular formula C20H26O6 and a molecular weight of 368.5 g/mol. IUPAC name: (2R,3R)-2,3-bis[(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)methyl]butane-1,4-diol. InChIKey: PUETUDUXMCLALY-CDXZYTGGSA-N.
| Molecular formula | C20H26O6 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | (2R,3R)-2,3-bis[(2,3,6-trideuterio-4-hydroxy-5-methoxyphenyl)methyl]butane-1,4-diol |
| InChIKey | PUETUDUXMCLALY-CDXZYTGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C[C@@H](CO)[C@@H](CC2=C(C(=C(C(=C2[2H])[2H])O)OC)[2H])CO)[2H])OC)O)[2H] |
Computed by PubChem (NCBI)