CAS 40336-80-9 appears in our catalog under these names: Mycophenolic Acid Impurity 5, Isopropyl Mycophenolate. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
Propan-2-yl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (CAS 40336-80-9) is a chemical compound with the molecular formula C20H26O6 and a molecular weight of 362.4 g/mol. IUPAC name: propan-2-yl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate. InChIKey: NLMMDPJTMSIANX-WUXMJOGZSA-N.
| Molecular formula | C20H26O6 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | propan-2-yl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| InChIKey | NLMMDPJTMSIANX-WUXMJOGZSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)OC(C)C)O |
Computed by PubChem (NCBI)