CAS 1346604-22-5 is the registry number for 2,5-Dihydro-2-hydroxy-5-nitro-2-furanmethanediol-d3 Triacetate. Offered by: TRC. Available pack sizes: 100mg, 10mg.
[acetyloxy-(2-acetyloxy-3,4,5-trideuterio-5-nitrofuran-2-yl)methyl] acetate (CAS 1346604-22-5) is a chemical compound with the molecular formula C11H13NO9 and a molecular weight of 306.24 g/mol. IUPAC name: [acetyloxy-(2-acetyloxy-3,4,5-trideuterio-5-nitrofuran-2-yl)methyl] acetate. InChIKey: OQQARHHKPBGAGA-NDEDDIEOSA-N.
| Molecular formula | C11H13NO9 |
|---|---|
| Molecular weight | 306.24 g/mol |
| IUPAC name | [acetyloxy-(2-acetyloxy-3,4,5-trideuterio-5-nitrofuran-2-yl)methyl] acetate |
| InChIKey | OQQARHHKPBGAGA-NDEDDIEOSA-N |
| SMILES | [2H]C1=C(C(OC1([2H])[N+](=O)[O-])(C(OC(=O)C)OC(=O)C)OC(=O)C)[2H] |
Computed by PubChem (NCBI)