CAS 5904-70-1 appears in our catalog under these names: Nifuratel Impurity 13, Nifuratel Impurity 8. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[acetyloxy-(5-acetyloxy-2-nitro-2H-furan-5-yl)methyl] acetate (CAS 5904-70-1) is a chemical compound with the molecular formula C11H13NO9 and a molecular weight of 303.22 g/mol. IUPAC name: [acetyloxy-(5-acetyloxy-2-nitro-2H-furan-5-yl)methyl] acetate. InChIKey: OQQARHHKPBGAGA-UHFFFAOYSA-N.
| Molecular formula | C11H13NO9 |
|---|---|
| Molecular weight | 303.22 g/mol |
| IUPAC name | [acetyloxy-(5-acetyloxy-2-nitro-2H-furan-5-yl)methyl] acetate |
| InChIKey | OQQARHHKPBGAGA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1(C=CC(O1)[N+](=O)[O-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)