Products 1346604-64-5

CAS 1346604-64-5 is the registry number for Ethyl 4-(2-N-Boc-2-aminoethyl)benzenesulfonamide carbamate. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[4-(ethoxycarbonylsulfamoyl)phenyl]ethyl]carbamate (CAS 1346604-64-5) is a chemical compound with the molecular formula C16H24N2O6S and a molecular weight of 372.4 g/mol. IUPAC name: tert-butyl N-[2-[4-(ethoxycarbonylsulfamoyl)phenyl]ethyl]carbamate. InChIKey: FZQVWVXTZXYWPP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24N2O6S
Molecular weight372.4 g/mol
IUPAC nametert-butyl N-[2-[4-(ethoxycarbonylsulfamoyl)phenyl]ethyl]carbamate
InChIKeyFZQVWVXTZXYWPP-UHFFFAOYSA-N
SMILESCCOC(=O)NS(=O)(=O)C1=CC=C(C=C1)CCNC(=O)OC(C)(C)C

Computed by PubChem (NCBI)