Products 930303-58-5
CAS 930303-58-5 is the registry number for Ethyl 2-(bis(tert-butoxycarbonyl)amino)thiazole-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylate (CAS 930303-58-5) is a chemical compound with the molecular formula C16H24N2O6S and a molecular weight of 372.4 g/mol. IUPAC name: ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylate. InChIKey: NPLNALYZDBTCPW-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O6S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-1,3-thiazole-4-carboxylate |
| InChIKey | NPLNALYZDBTCPW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)