Products 1346604-80-5
CAS 1346604-80-5 is the registry number for N,N-Diisopropyltryptamine Oxalate. Offered by: TRC. Available pack sizes: 100mg.
N-[2-(1H-indol-3-yl)ethyl]-N-propan-2-ylpropan-2-amine;oxalic acid (CAS 1346604-80-5) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: N-[2-(1H-indol-3-yl)ethyl]-N-propan-2-ylpropan-2-amine;oxalic acid. InChIKey: OTBAKMLNZXZOCB-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | N-[2-(1H-indol-3-yl)ethyl]-N-propan-2-ylpropan-2-amine;oxalic acid |
| InChIKey | OTBAKMLNZXZOCB-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCC1=CNC2=CC=CC=C21)C(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)