Products 1346605-30-8
CAS 1346605-30-8 appears in our catalog under these names: 2-(1-Hydroxyethyl) Promazine-d4 Sulfoxide, >95% (HPLC), 2-(1-Hydroxyethyl) promazine-d4 Sulfoxide. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1-[6,7,8,9-tetradeuterio-10-[3-(dimethylamino)propyl]-5-oxophenothiazin-2-yl]ethanol (CAS 1346605-30-8) is a chemical compound with the molecular formula C19H24N2O2S and a molecular weight of 348.5 g/mol. IUPAC name: 1-[6,7,8,9-tetradeuterio-10-[3-(dimethylamino)propyl]-5-oxophenothiazin-2-yl]ethanol. InChIKey: PMRKLUFRQDNKCL-YBNXMSKUSA-N.
| Molecular formula | C19H24N2O2S |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 1-[6,7,8,9-tetradeuterio-10-[3-(dimethylamino)propyl]-5-oxophenothiazin-2-yl]ethanol |
| InChIKey | PMRKLUFRQDNKCL-YBNXMSKUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])N(C3=C(S2=O)C=CC(=C3)C(C)O)CCCN(C)C)[2H])[2H] |
Computed by PubChem (NCBI)