Products 73644-42-5

CAS 73644-42-5 is the registry number for 2-(1-Hydroxyethyl) Promazine Sulfoxide (mixture of diastereomers), >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 2,5mg.

Structural formula: {0} (CAS {1})

1-[10-[3-(dimethylamino)propyl]-5-oxophenothiazin-2-yl]ethanol (CAS 73644-42-5) is a chemical compound with the molecular formula C19H24N2O2S and a molecular weight of 344.5 g/mol. IUPAC name: 1-[10-[3-(dimethylamino)propyl]-5-oxophenothiazin-2-yl]ethanol. InChIKey: PMRKLUFRQDNKCL-UHFFFAOYSA-N.

Identity
Molecular formulaC19H24N2O2S
Molecular weight344.5 g/mol
IUPAC name1-[10-[3-(dimethylamino)propyl]-5-oxophenothiazin-2-yl]ethanol
InChIKeyPMRKLUFRQDNKCL-UHFFFAOYSA-N
SMILESCC(C1=CC2=C(C=C1)S(=O)C3=CC=CC=C3N2CCCN(C)C)O

Computed by PubChem (NCBI)