Products 1346606-17-4
CAS 1346606-17-4 is the registry number for Deschloro Clomiphene-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
N,N-diethyl-2-[4-[(Z)-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylethenyl]phenoxy]ethanamine (CAS 1346606-17-4) is a chemical compound with the molecular formula C26H29NO and a molecular weight of 376.5 g/mol. IUPAC name: N,N-diethyl-2-[4-[(Z)-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylethenyl]phenoxy]ethanamine. InChIKey: YOKPBLYAKJJMQO-IBEQMINASA-N.
| Molecular formula | C26H29NO |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | N,N-diethyl-2-[4-[(Z)-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylethenyl]phenoxy]ethanamine |
| InChIKey | YOKPBLYAKJJMQO-IBEQMINASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C=C(/C2=CC=CC=C2)\C3=CC=C(C=C3)OCCN(CC)CC)[2H])[2H] |
Computed by PubChem (NCBI)