CAS 19957-52-9 appears in our catalog under these names: Clomifene Impurity 1(Clomifene EP Impurity A), Clomifene citrate EP Impurity A(Deschloro Clomiphene), Deschloro Clomiphene, Deschloro Clomiphene (E/Z Mixture), >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 500mg.
2-[4-[(E)-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine (CAS 19957-52-9) is a chemical compound with the molecular formula C26H29NO and a molecular weight of 371.5 g/mol. IUPAC name: 2-[4-[(E)-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine. InChIKey: YOKPBLYAKJJMQO-YYADALCUSA-N.
| Molecular formula | C26H29NO |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 2-[4-[(E)-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine |
| InChIKey | YOKPBLYAKJJMQO-YYADALCUSA-N |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)/C(=C/C2=CC=CC=C2)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)