CAS 1346606-48-1 is the registry number for 3-Amino-6-chloro-4-(4-pyridinyl)-2-quinolinone Hydrazone. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg.
6-chloro-2-hydrazinyl-4-phenylquinolin-3-amine (CAS 1346606-48-1) is a chemical compound with the molecular formula C15H13ClN4 and a molecular weight of 284.74 g/mol. IUPAC name: 6-chloro-2-hydrazinyl-4-phenylquinolin-3-amine. InChIKey: UVOZQOLICSPWHS-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 6-chloro-2-hydrazinyl-4-phenylquinolin-3-amine |
| InChIKey | UVOZQOLICSPWHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NC3=C2C=C(C=C3)Cl)NN)N |
Computed by PubChem (NCBI)