CAS 18091-89-9 appears in our catalog under these names: 7-Chloro-2-hydrazino-5-phenyl-3H-1,4-benzodiazepine (1mg/ml in Acetonitrile), 7-Chloro-2-hydrazino-5-phenyl-3H-1,4-benzodiazepine, >95% (HPLC), 7-Chloro-2-hydrazino-5-phenyl-3H-1,4-benzodiazepine. Offered by: TRC, Biosynth. Available pack sizes: 5x1ml, 10mg, 5mg, 25mg, 100mg, 50mg.
(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazine (CAS 18091-89-9) is a chemical compound with the molecular formula C15H13ClN4 and a molecular weight of 284.74 g/mol. IUPAC name: (7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazine. InChIKey: GWSXDWFXNVOIIC-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | (7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazine |
| InChIKey | GWSXDWFXNVOIIC-UHFFFAOYSA-N |
| SMILES | C1C(=NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3)NN |
Computed by PubChem (NCBI)