CAS 1346608-65-8 appears in our catalog under these names: 2-Fluoro-3-isopropoxybenzoic acid, 97%, 2–Fluoro–3–isopropoxybenzoic acid, 2-Fluoro-3-isopropoxybenzoic acid 97%, 2-Fluoro-3-isopropoxybenzoic acid, 98%, 98%, 2-Fluoro-3-isopropoxybenzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-fluoro-3-propan-2-yloxybenzoic acid (CAS 1346608-65-8) is a chemical compound with the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. IUPAC name: 2-fluoro-3-propan-2-yloxybenzoic acid. InChIKey: ADISUGFAMDFUHD-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 2-fluoro-3-propan-2-yloxybenzoic acid |
| InChIKey | ADISUGFAMDFUHD-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC(=C1F)C(=O)O |
Computed by PubChem (NCBI)