CAS 289039-81-2 appears in our catalog under these names: 2-Fluoro-4-isopropyloxybenzoic acid, 2-Fluoro-4-isopropoxybenzoic acid, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 5g, 10g, 1g.
2-fluoro-4-propan-2-yloxybenzoic acid (CAS 289039-81-2) is a chemical compound with the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. IUPAC name: 2-fluoro-4-propan-2-yloxybenzoic acid. InChIKey: LFYMPARUPZDGHJ-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 2-fluoro-4-propan-2-yloxybenzoic acid |
| InChIKey | LFYMPARUPZDGHJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)