Products 1346617-04-6
CAS 1346617-04-6 is the registry number for (S)-4-Hydroxy Penbutolol Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
4-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3-cyclopentylphenol;hydrochloride (CAS 1346617-04-6) is a chemical compound with the molecular formula C18H30ClNO3 and a molecular weight of 343.9 g/mol. IUPAC name: 4-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3-cyclopentylphenol;hydrochloride. InChIKey: IRXCLCQOLQYHQP-RSAXXLAASA-N.
| Molecular formula | C18H30ClNO3 |
|---|---|
| Molecular weight | 343.9 g/mol |
| IUPAC name | 4-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3-cyclopentylphenol;hydrochloride |
| InChIKey | IRXCLCQOLQYHQP-RSAXXLAASA-N |
| SMILES | CC(C)(C)NC[C@@H](COC1=C(C=C(C=C1)O)C2CCCC2)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-4-Hydroxy Penbutolol Hydrochloride