CAS 63659-19-8 appears in our catalog under these names: Betaxolol hydrochloride, 95%, Betaxolol Hydrochloride, >95% (HPLC), Betaxolol Hydrochloride, Betaxolol hydrochloride/ 99.56% (existing batch purity), Betaxolol HCl. Offered by: Combi-blocks, TRC, Mikromol, LoGiCal, Dr. Ehrenstorfer. Available pack sizes: 100mg, 250mg, 10mg, 5mg, 25mg, 50mg, 200mg, 500mg.
1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol;hydrochloride (CAS 63659-19-8) is a chemical compound with the molecular formula C18H30ClNO3 and a molecular weight of 343.9 g/mol. IUPAC name: 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol;hydrochloride. InChIKey: CHDPSNLJFOQTRK-UHFFFAOYSA-N.
| Molecular formula | C18H30ClNO3 |
|---|---|
| Molecular weight | 343.9 g/mol |
| IUPAC name | 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| InChIKey | CHDPSNLJFOQTRK-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCOCC2CC2)O.Cl |
Computed by PubChem (NCBI)