CAS 1346642-91-8 is the registry number for Quinolinic acid-13C7. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2,3,4,5,6-13C5)pyridine-2,3-dicarboxylic acid (CAS 1346642-91-8) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 174.068 g/mol. IUPAC name: (2,3,4,5,6-13C5)pyridine-2,3-dicarboxylic acid. InChIKey: GJAWHXHKYYXBSV-BNUYUSEDSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 174.068 g/mol |
| IUPAC name | (2,3,4,5,6-13C5)pyridine-2,3-dicarboxylic acid |
| InChIKey | GJAWHXHKYYXBSV-BNUYUSEDSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C](N=[13CH]1)[13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)