Products 134732-52-8

CAS 134732-52-8 is the registry number for (1R)-2-Azabicyclo[3.1.0]hexane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

(1R)-2-azabicyclo[3.1.0]hexane-1-carboxylic acid (CAS 134732-52-8) is a chemical compound with the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. IUPAC name: (1R)-2-azabicyclo[3.1.0]hexane-1-carboxylic acid. InChIKey: CLPZNYCYBYIODB-BAFYGKSASA-N.

Identity
Molecular formulaC6H9NO2
Molecular weight127.14 g/mol
IUPAC name(1R)-2-azabicyclo[3.1.0]hexane-1-carboxylic acid
InChIKeyCLPZNYCYBYIODB-BAFYGKSASA-N
SMILESC1CN[C@]2(C1C2)C(=O)O

Computed by PubChem (NCBI)