CAS 1347749-97-6 appears in our catalog under these names: UNC10217938A, 97%, UNC10217938A, Ethyl 8-(2-(dimethylamino)ethylamino)-2,3-diphenylpyrido[2,3-b]pyrazin-6-ylcarbamate, 99.41%, 99.41%, UNC10217938A, 99.75%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 10mg, 5mg, 1mg, 2mg, 10 mg.
Ethyl N-[8-[2-(dimethylamino)ethylamino]-2,3-diphenylpyrido[2,3-b]pyrazin-6-yl]carbamate (CAS 1347749-97-6) is a chemical compound with the molecular formula C26H28N6O2 and a molecular weight of 456.5 g/mol. IUPAC name: ethyl N-[8-[2-(dimethylamino)ethylamino]-2,3-diphenylpyrido[2,3-b]pyrazin-6-yl]carbamate. InChIKey: HHICWLZMNOCMIQ-UHFFFAOYSA-N.
| Molecular formula | C26H28N6O2 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | ethyl N-[8-[2-(dimethylamino)ethylamino]-2,3-diphenylpyrido[2,3-b]pyrazin-6-yl]carbamate |
| InChIKey | HHICWLZMNOCMIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=NC2=C(C(=C1)NCCN(C)C)N=C(C(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)