Products 2366279-99-2

CAS 2366279-99-2 is the registry number for Myoferlin inhibitor 1, 99.88%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 5 mg, 10mM/1mL, 25 mg, 10 mg, 100 mg.

Structural formula: {0} (CAS {1})

3-[3-ethyl-5-(5-methoxypyrimidin-2-yl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide (CAS 2366279-99-2) is a chemical compound with the molecular formula C26H28N6O2 and a molecular weight of 456.5 g/mol. IUPAC name: 3-[3-ethyl-5-(5-methoxypyrimidin-2-yl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide. InChIKey: AASLOEMOCBUITM-UHFFFAOYSA-N.

Identity
Molecular formulaC26H28N6O2
Molecular weight456.5 g/mol
IUPAC name3-[3-ethyl-5-(5-methoxypyrimidin-2-yl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide
InChIKeyAASLOEMOCBUITM-UHFFFAOYSA-N
SMILESCCC1=NN(C(=N1)C2=NC=C(C=N2)OC)C3=CC=CC(=C3)C(=O)NCCCCC4=CC=CC=C4

Computed by PubChem (NCBI)