CAS 1347759-12-9 is the registry number for 1-(2,4,6-Trichloropyridin-3-yl)ethan-1-ol, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,4,6-trichloro-3-pyridinyl)ethanol (CAS 1347759-12-9) is a chemical compound with the molecular formula C7H6Cl3NO and a molecular weight of 226.5 g/mol. IUPAC name: 1-(2,4,6-trichloro-3-pyridinyl)ethanol. InChIKey: RVSREINDRJCVGM-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3NO |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(2,4,6-trichloro-3-pyridinyl)ethanol |
| InChIKey | RVSREINDRJCVGM-UHFFFAOYSA-N |
| SMILES | CC(C1=C(N=C(C=C1Cl)Cl)Cl)O |
Computed by PubChem (NCBI)